C19H14O5 — CID 51099531
3-[3-[(1,3-dioxoinden-2-ylidene)methyl]phenoxy]propanoic acid (PubChem CID 51099531) has the molecular formula C19H14O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is 3-[3-[(1,3-dioxoinden-2-ylidene)methyl]phenoxy]propanoic acid.
| Compound Name | 3-[3-[(1,3-dioxoinden-2-ylidene)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 51099531 |
| Molecular Formula | C19H14O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-[3-[(1,3-dioxoinden-2-ylidene)methyl]phenoxy]propanoic acid |
| SMILES | O=C(O)CCOc1cccc(C=C2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C19H14O5/c20-17(21)8-9-24-13-5-3-4-12(10-13)11-16-18(22)14-6-1-2-7-15(14)19(16)23/h1-7,10-11H,8-9H2,(H,20,21) |
| InChIKey | PMLNYKJLSJXTLT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|