C19H16N2O4S2 — CID 27413646
3-[3-[(E)-(3-anilino-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoic acid (PubChem CID 27413646) has the molecular formula C19H16N2O4S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 3-[3-[(E)-(3-anilino-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoic acid.
| Compound Name | 3-[3-[(E)-(3-anilino-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 27413646 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 3-[3-[(E)-(3-anilino-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoic acid |
| SMILES | O=C(O)CCOc1cccc(/C=C2/SC(=S)N(Nc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C19H16N2O4S2/c22-17(23)9-10-25-15-8-4-5-13(11-15)12-16-18(24)21(19(26)27-16)20-14-6-2-1-3-7-14/h1-8,11-12,20H,9-10H2,(H,22,23)/b16-12+ |
| InChIKey | RFLAHSMRHCWZPG-FOWTUZBSSA-N |
| XLogP | 3.77 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|