C23H15NO5 — CID 126394548
2-[[3-[(4-nitrophenyl)methoxy]phenyl]methylidene]indene-1,3-dione (PubChem CID 126394548) has the molecular formula C23H15NO5 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-[[3-[(4-nitrophenyl)methoxy]phenyl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[3-[(4-nitrophenyl)methoxy]phenyl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 126394548 |
| Molecular Formula | C23H15NO5 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[[3-[(4-nitrophenyl)methoxy]phenyl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2cccc(OCc3ccc([N+](=O)[O-])cc3)c2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C23H15NO5/c25-22-19-6-1-2-7-20(19)23(26)21(22)13-16-4-3-5-18(12-16)29-14-15-8-10-17(11-9-15)24(27)28/h1-13H,14H2 |
| InChIKey | BLPPJPXGXUPVEY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|