C28H23N3O4 — CID 126397217
N-[(Z)-[3-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide (PubChem CID 126397217) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is N-[(Z)-[3-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(Z)-[3-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 126397217 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-[(Z)-[3-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2,2-diphenylacetamide |
| SMILES | O=C(N/N=C\c1cccc(OCc2ccc([N+](=O)[O-])cc2)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H23N3O4/c32-28(27(23-9-3-1-4-10-23)24-11-5-2-6-12-24)30-29-19-22-8-7-13-26(18-22)35-20-21-14-16-25(17-15-21)31(33)34/h1-19,27H,20H2,(H,30,32)/b29-19- |
| InChIKey | RGAJVEAWPXLKRQ-CEUNXORHSA-N |
| XLogP | 5.46 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|