C20H15N3O4 — CID 47077449
(4Z)-4-[[4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]methylidene]isoquinoline-1,3-dione (PubChem CID 47077449) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is (4Z)-4-[[4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]methylidene]isoquinoline-1,3-dione.
| Compound Name | (4Z)-4-[[4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]methylidene]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 47077449 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (4Z)-4-[[4-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]phenyl]methylidene]isoquinoline-1,3-dione |
| SMILES | Cc1nc(COc2ccc(/C=C3\C(=O)NC(=O)c4ccccc43)cc2)no1 |
| InChI | InChI=1S/C20H15N3O4/c1-12-21-18(23-27-12)11-26-14-8-6-13(7-9-14)10-17-15-4-2-3-5-16(15)19(24)22-20(17)25/h2-10H,11H2,1H3,(H,22,24,25)/b17-10- |
| InChIKey | KONGBPYDOIHQSD-YVLHZVERSA-N |
| XLogP | 2.77 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|