C16H11N3O6S2 — CID 16627394
[4-[(Z)-(4-amino-2-oxo-1,3-thiazol-5-ylidene)methyl]-2-methoxyphenyl] (2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetate (PubChem CID 16627394) has the molecular formula C16H11N3O6S2 and a molecular weight of 405.41 g/mol. Its IUPAC name is [4-[(Z)-(4-amino-2-oxo-1,3-thiazol-5-ylidene)methyl]-2-methoxyphenyl] (2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetate.
| Compound Name | [4-[(Z)-(4-amino-2-oxo-1,3-thiazol-5-ylidene)methyl]-2-methoxyphenyl] (2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetate |
|---|---|
| PubChem CID | 16627394 |
| Molecular Formula | C16H11N3O6S2 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | [4-[(Z)-(4-amino-2-oxo-1,3-thiazol-5-ylidene)methyl]-2-methoxyphenyl] (2E)-2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetate |
| SMILES | COc1cc(/C=C2\SC(=O)N=C2N)ccc1OC(=O)/C=C1/SC(=O)NC1=O |
| InChI | InChI=1S/C16H11N3O6S2/c1-24-9-4-7(5-10-13(17)18-15(22)26-10)2-3-8(9)25-12(20)6-11-14(21)19-16(23)27-11/h2-6H,1H3,(H2,17,18,22)(H,19,21,23)/b10-5-,11-6+ |
| InChIKey | VECQBGQXQXEMMZ-JZKFVHIFSA-N |
| XLogP | 2.03 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|