C19H25NO2 — CID 52532242
(2Z,4R)-4-methyl-2-[[4-(3-methylbutoxy)phenyl]methylidene]-3-oxohexanenitrile (PubChem CID 52532242) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (2Z,4R)-4-methyl-2-[[4-(3-methylbutoxy)phenyl]methylidene]-3-oxohexanenitrile.
| Compound Name | (2Z,4R)-4-methyl-2-[[4-(3-methylbutoxy)phenyl]methylidene]-3-oxohexanenitrile |
|---|---|
| PubChem CID | 52532242 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (2Z,4R)-4-methyl-2-[[4-(3-methylbutoxy)phenyl]methylidene]-3-oxohexanenitrile |
| SMILES | CC[C@@H](C)C(=O)/C(C#N)=C\c1ccc(OCCC(C)C)cc1 |
| InChI | InChI=1S/C19H25NO2/c1-5-15(4)19(21)17(13-20)12-16-6-8-18(9-7-16)22-11-10-14(2)3/h6-9,12,14-15H,5,10-11H2,1-4H3/b17-12-/t15-/m1/s1 |
| InChIKey | ZWHRTKFDUHMLTD-UHVIJJLKSA-N |
| XLogP | 4.63 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|