C22H19N3O3 — CID 7841935
[(1S)-1-cyanoethyl] (E)-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 7841935) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] (E)-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [(1S)-1-cyanoethyl] (E)-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7841935 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | [(1S)-1-cyanoethyl] (E)-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=C/C(=O)O[C@@H](C)C#N)cc1 |
| InChI | InChI=1S/C22H19N3O3/c1-16(14-23)28-21(26)13-10-18-15-25(19-6-4-3-5-7-19)24-22(18)17-8-11-20(27-2)12-9-17/h3-13,15-16H,1-2H3/b13-10+/t16-/m0/s1 |
| InChIKey | KHMDDIIEVVUXDG-ISBHARSQSA-N |
| XLogP | 4.02 |
| TPSA | 77.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|