C12H12N2O4S — CID 54868379
(E)-4-[2-(2-amino-2-oxoethyl)sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 54868379) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is (E)-4-[2-(2-amino-2-oxoethyl)sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[2-(2-amino-2-oxoethyl)sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54868379 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (E)-4-[2-(2-amino-2-oxoethyl)sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | NC(=O)CSc1ccccc1NC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C12H12N2O4S/c13-10(15)7-19-9-4-2-1-3-8(9)14-11(16)5-6-12(17)18/h1-6H,7H2,(H2,13,15)(H,14,16)(H,17,18)/b6-5+ |
| InChIKey | UQFJITAROIOTFP-AATRIKPKSA-N |
| XLogP | 0.84 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|