C12H15ClN2O2S — CID 62727753
N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-chloro-2-methylpropanamide (PubChem CID 62727753) has the molecular formula C12H15ClN2O2S and a molecular weight of 286.78 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-chloro-2-methylpropanamide.
| Compound Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-chloro-2-methylpropanamide |
|---|---|
| PubChem CID | 62727753 |
| Molecular Formula | C12H15ClN2O2S |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-chloro-2-methylpropanamide |
| SMILES | CC(CCl)C(=O)Nc1ccccc1SCC(N)=O |
| InChI | InChI=1S/C12H15ClN2O2S/c1-8(6-13)12(17)15-9-4-2-3-5-10(9)18-7-11(14)16/h2-5,8H,6-7H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | ZBCUESDRGNCZDU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|