C15H13Cl2N3O2S — CID 7997047
2-[2-[(3,4-dichlorophenyl)carbamoylamino]phenyl]sulfanylacetamide (PubChem CID 7997047) has the molecular formula C15H13Cl2N3O2S and a molecular weight of 370.26 g/mol. Its IUPAC name is 2-[2-[(3,4-dichlorophenyl)carbamoylamino]phenyl]sulfanylacetamide.
| Compound Name | 2-[2-[(3,4-dichlorophenyl)carbamoylamino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 7997047 |
| Molecular Formula | C15H13Cl2N3O2S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 2-[2-[(3,4-dichlorophenyl)carbamoylamino]phenyl]sulfanylacetamide |
| SMILES | NC(=O)CSc1ccccc1NC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2N3O2S/c16-10-6-5-9(7-11(10)17)19-15(22)20-12-3-1-2-4-13(12)23-8-14(18)21/h1-7H,8H2,(H2,18,21)(H2,19,20,22) |
| InChIKey | CRRHLVDZDJXAFM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |