C14H12Cl2N2O3S2 — CID 9068061
2-[2-[(3,4-dichlorophenyl)sulfonylamino]phenyl]sulfanylacetamide (PubChem CID 9068061) has the molecular formula C14H12Cl2N2O3S2 and a molecular weight of 391.30 g/mol. Its IUPAC name is 2-[2-[(3,4-dichlorophenyl)sulfonylamino]phenyl]sulfanylacetamide.
| Compound Name | 2-[2-[(3,4-dichlorophenyl)sulfonylamino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 9068061 |
| Molecular Formula | C14H12Cl2N2O3S2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 2-[2-[(3,4-dichlorophenyl)sulfonylamino]phenyl]sulfanylacetamide |
| SMILES | NC(=O)CSc1ccccc1NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H12Cl2N2O3S2/c15-10-6-5-9(7-11(10)16)23(20,21)18-12-3-1-2-4-13(12)22-8-14(17)19/h1-7,18H,8H2,(H2,17,19) |
| InChIKey | RHKAGPPQVYOXEE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |