C16H15ClN2O3S2 — CID 9068119
2-[2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]phenyl]sulfanylacetamide (PubChem CID 9068119) has the molecular formula C16H15ClN2O3S2 and a molecular weight of 382.89 g/mol. Its IUPAC name is 2-[2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]phenyl]sulfanylacetamide.
| Compound Name | 2-[2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 9068119 |
| Molecular Formula | C16H15ClN2O3S2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 2-[2-[[(E)-2-(4-chlorophenyl)ethenyl]sulfonylamino]phenyl]sulfanylacetamide |
| SMILES | NC(=O)CSc1ccccc1NS(=O)(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClN2O3S2/c17-13-7-5-12(6-8-13)9-10-24(21,22)19-14-3-1-2-4-15(14)23-11-16(18)20/h1-10,19H,11H2,(H2,18,20)/b10-9+ |
| InChIKey | OZIWFNAXPBHSIA-MDZDMXLPSA-N |
| XLogP | 3.33 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |