C14H13BrN2O3S2 — CID 9068095
2-[2-[(3-bromophenyl)sulfonylamino]phenyl]sulfanylacetamide (PubChem CID 9068095) has the molecular formula C14H13BrN2O3S2 and a molecular weight of 401.31 g/mol. Its IUPAC name is 2-[2-[(3-bromophenyl)sulfonylamino]phenyl]sulfanylacetamide.
| Compound Name | 2-[2-[(3-bromophenyl)sulfonylamino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 9068095 |
| Molecular Formula | C14H13BrN2O3S2 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | 2-[2-[(3-bromophenyl)sulfonylamino]phenyl]sulfanylacetamide |
| SMILES | NC(=O)CSc1ccccc1NS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H13BrN2O3S2/c15-10-4-3-5-11(8-10)22(19,20)17-12-6-1-2-7-13(12)21-9-14(16)18/h1-8,17H,9H2,(H2,16,18) |
| InChIKey | SMUOBBVSLQEQEK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |