C26H25ClN4O4S — CID 4700497
3-[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 4700497) has the molecular formula C26H25ClN4O4S and a molecular weight of 525.03 g/mol. Its IUPAC name is 3-[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | 3-[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4700497 |
| Molecular Formula | C26H25ClN4O4S |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 3-[3-(3-chloro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]-2-cyano-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2C=C(C#N)C(=O)NC2CCS(=O)(=O)C2)cc1Cl |
| InChI | InChI=1S/C26H25ClN4O4S/c1-2-11-35-24-9-8-18(14-23(24)27)25-20(16-31(30-25)22-6-4-3-5-7-22)13-19(15-28)26(32)29-21-10-12-36(33,34)17-21/h3-9,13-14,16,21H,2,10-12,17H2,1H3,(H,29,32) |
| InChIKey | CPZYUCGOOCZEQB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|