C25H17N5 — CID 25369775
(Z)-3-(1,3-diphenylpyrazol-4-yl)-2-imidazo[1,2-a]pyridin-2-ylprop-2-enenitrile (PubChem CID 25369775) has the molecular formula C25H17N5 and a molecular weight of 387.45 g/mol. Its IUPAC name is (Z)-3-(1,3-diphenylpyrazol-4-yl)-2-imidazo[1,2-a]pyridin-2-ylprop-2-enenitrile.
| Compound Name | (Z)-3-(1,3-diphenylpyrazol-4-yl)-2-imidazo[1,2-a]pyridin-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 25369775 |
| Molecular Formula | C25H17N5 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (Z)-3-(1,3-diphenylpyrazol-4-yl)-2-imidazo[1,2-a]pyridin-2-ylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1cn(-c2ccccc2)nc1-c1ccccc1)c1cn2ccccc2n1 |
| InChI | InChI=1S/C25H17N5/c26-16-20(23-18-29-14-8-7-13-24(29)27-23)15-21-17-30(22-11-5-2-6-12-22)28-25(21)19-9-3-1-4-10-19/h1-15,17-18H/b20-15+ |
| InChIKey | XSQQBCLJDUQKKW-HMMYKYKNSA-N |
| XLogP | 5.25 |
| TPSA | 58.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|