C25H20ClN5O3 — CID 34299352
3-chloro-N-[2-[2-(1,3-diphenylpyrazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 34299352) has the molecular formula C25H20ClN5O3 and a molecular weight of 473.92 g/mol. Its IUPAC name is 3-chloro-N-[2-[2-(1,3-diphenylpyrazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[2-(1,3-diphenylpyrazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 34299352 |
| Molecular Formula | C25H20ClN5O3 |
| Molecular Weight | 473.92 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 3-chloro-N-[2-[2-(1,3-diphenylpyrazole-4-carbonyl)hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Cl)c1)NNC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H20ClN5O3/c26-19-11-7-10-18(14-19)24(33)27-15-22(32)28-29-25(34)21-16-31(20-12-5-2-6-13-20)30-23(21)17-8-3-1-4-9-17/h1-14,16H,15H2,(H,27,33)(H,28,32)(H,29,34) |
| InChIKey | VFFRLYBBZPJGSU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|