C25H24N4O2 — CID 8518699
N-[(Z)-[3-(2,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2,5-dimethylfuran-3-carboxamide (PubChem CID 8518699) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-[(Z)-[3-(2,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[(Z)-[3-(2,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 8518699 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-[(Z)-[3-(2,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2/C=N\NC(=O)c2cc(C)oc2C)c(C)c1 |
| InChI | InChI=1S/C25H24N4O2/c1-16-10-11-22(17(2)12-16)24-20(15-29(28-24)21-8-6-5-7-9-21)14-26-27-25(30)23-13-18(3)31-19(23)4/h5-15H,1-4H3,(H,27,30)/b26-14- |
| InChIKey | OHLVZCNJQQEYPS-WGARJPEWSA-N |
| XLogP | 5.13 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|