C15H14N4O3 — CID 4789694
N'-(2,5-dimethylfuran-3-carbonyl)-1H-indazole-3-carbohydrazide (PubChem CID 4789694) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is N'-(2,5-dimethylfuran-3-carbonyl)-1H-indazole-3-carbohydrazide.
| Compound Name | N'-(2,5-dimethylfuran-3-carbonyl)-1H-indazole-3-carbohydrazide |
|---|---|
| PubChem CID | 4789694 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N'-(2,5-dimethylfuran-3-carbonyl)-1H-indazole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2n[nH]c3ccccc23)c(C)o1 |
| InChI | InChI=1S/C15H14N4O3/c1-8-7-11(9(2)22-8)14(20)18-19-15(21)13-10-5-3-4-6-12(10)16-17-13/h3-7H,1-2H3,(H,16,17)(H,18,20)(H,19,21) |
| InChIKey | HIVTYXYPKRCEEZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|