C20H29N5O3S — CID 9093720
1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-cyclohexyl-1-(furan-2-ylmethyl)thiourea (PubChem CID 9093720) has the molecular formula C20H29N5O3S and a molecular weight of 419.55 g/mol. Its IUPAC name is 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-cyclohexyl-1-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-cyclohexyl-1-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 9093720 |
| Molecular Formula | C20H29N5O3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-3-cyclohexyl-1-(furan-2-ylmethyl)thiourea |
| SMILES | CCCCn1c(N)c(N(Cc2ccco2)C(=S)NC2CCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H29N5O3S/c1-2-3-11-24-17(21)16(18(26)23-19(24)27)25(13-15-10-7-12-28-15)20(29)22-14-8-5-4-6-9-14/h7,10,12,14H,2-6,8-9,11,13,21H2,1H3,(H,22,29)(H,23,26,27) |
| InChIKey | UUHAJKJWEVHBKA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|