C23H22F4N4O4 — CID 26206422
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2,3,4,5-tetrafluoro-N-[(2-methoxyphenyl)methyl]benzamide (PubChem CID 26206422) has the molecular formula C23H22F4N4O4 and a molecular weight of 494.45 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2,3,4,5-tetrafluoro-N-[(2-methoxyphenyl)methyl]benzamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2,3,4,5-tetrafluoro-N-[(2-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 26206422 |
| Molecular Formula | C23H22F4N4O4 |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-2,3,4,5-tetrafluoro-N-[(2-methoxyphenyl)methyl]benzamide |
| SMILES | CCCCn1c(N)c(N(Cc2ccccc2OC)C(=O)c2cc(F)c(F)c(F)c2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H22F4N4O4/c1-3-4-9-30-20(28)19(21(32)29-23(30)34)31(11-12-7-5-6-8-15(12)35-2)22(33)13-10-14(24)17(26)18(27)16(13)25/h5-8,10H,3-4,9,11,28H2,1-2H3,(H,29,32,34) |
| InChIKey | IWVKWCHVSDVAES-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|