C22H27N7O5 — CID 55699441
N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butyl-1-(4-nitrophenyl)pyrazole-4-carboxamide (PubChem CID 55699441) has the molecular formula C22H27N7O5 and a molecular weight of 469.50 g/mol. Its IUPAC name is N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butyl-1-(4-nitrophenyl)pyrazole-4-carboxamide.
| Compound Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butyl-1-(4-nitrophenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55699441 |
| Molecular Formula | C22H27N7O5 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-[6-amino-1-(2-methylpropyl)-2,4-dioxopyrimidin-5-yl]-N-butyl-1-(4-nitrophenyl)pyrazole-4-carboxamide |
| SMILES | CCCCN(C(=O)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1)c1c(N)n(CC(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H27N7O5/c1-4-5-10-26(18-19(23)27(12-14(2)3)22(32)25-20(18)30)21(31)15-11-24-28(13-15)16-6-8-17(9-7-16)29(33)34/h6-9,11,13-14H,4-5,10,12,23H2,1-3H3,(H,25,30,32) |
| InChIKey | LCGDRJAUHBQTTQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 162.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|