C17H20N2O6S2 — CID 8515211
ethyl 5-[(4-acetamido-3-methoxyphenyl)sulfonylamino]-3-methylthiophene-2-carboxylate (PubChem CID 8515211) has the molecular formula C17H20N2O6S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is ethyl 5-[(4-acetamido-3-methoxyphenyl)sulfonylamino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[(4-acetamido-3-methoxyphenyl)sulfonylamino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 8515211 |
| Molecular Formula | C17H20N2O6S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | ethyl 5-[(4-acetamido-3-methoxyphenyl)sulfonylamino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NS(=O)(=O)c2ccc(NC(C)=O)c(OC)c2)cc1C |
| InChI | InChI=1S/C17H20N2O6S2/c1-5-25-17(21)16-10(2)8-15(26-16)19-27(22,23)12-6-7-13(18-11(3)20)14(9-12)24-4/h6-9,19H,5H2,1-4H3,(H,18,20) |
| InChIKey | CZSYAENKHREZGF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |