C27H38BrI2NO6 — CID 157282265
tert-butyl N-(2-bromoethyl)carbamate;tert-butyl 4-(4-iodophenoxy)butanoate;4-iodophenol (PubChem CID 157282265) has the molecular formula C27H38BrI2NO6 and a molecular weight of 806.31 g/mol. Its IUPAC name is tert-butyl N-(2-bromoethyl)carbamate;tert-butyl 4-(4-iodophenoxy)butanoate;4-iodophenol.
| Compound Name | tert-butyl N-(2-bromoethyl)carbamate;tert-butyl 4-(4-iodophenoxy)butanoate;4-iodophenol |
|---|---|
| PubChem CID | 157282265 |
| Molecular Formula | C27H38BrI2NO6 |
| Molecular Weight | 806.31 g/mol |
| Exact Mass | 805.00 |
| IUPAC Name | tert-butyl N-(2-bromoethyl)carbamate;tert-butyl 4-(4-iodophenoxy)butanoate;4-iodophenol |
| SMILES | CC(C)(C)OC(=O)CCCOc1ccc(I)cc1.CC(C)(C)OC(=O)NCCBr.Oc1ccc(I)cc1 |
| InChI | InChI=1S/C14H19IO3.C7H14BrNO2.C6H5IO/c1-14(2,3)18-13(16)5-4-10-17-12-8-6-11(15)7-9-12;1-7(2,3)11-6(10)9-5-4-8;7-5-1-3-6(8)4-2-5/h6-9H,4-5,10H2,1-3H3;4-5H2,1-3H3,(H,9,10);1-4,8H |
| InChIKey | AZUNWVZISNWAGW-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.31 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|