C38H59IN2O6Si2 — CID 157090125
tert-butyl N-[3-(4-iodophenoxy)propyl]carbamate;tert-butyl N-[3-[4-(2-trimethylsilylethynyl)phenoxy]propyl]carbamate;ethynyl(trimethyl)silane (PubChem CID 157090125) has the molecular formula C38H59IN2O6Si2 and a molecular weight of 822.97 g/mol. Its IUPAC name is tert-butyl N-[3-(4-iodophenoxy)propyl]carbamate;tert-butyl N-[3-[4-(2-trimethylsilylethynyl)phenoxy]propyl]carbamate;ethynyl(trimethyl)silane.
| Compound Name | tert-butyl N-[3-(4-iodophenoxy)propyl]carbamate;tert-butyl N-[3-[4-(2-trimethylsilylethynyl)phenoxy]propyl]carbamate;ethynyl(trimethyl)silane |
|---|---|
| PubChem CID | 157090125 |
| Molecular Formula | C38H59IN2O6Si2 |
| Molecular Weight | 822.97 g/mol |
| Exact Mass | 822.30 |
| IUPAC Name | tert-butyl N-[3-(4-iodophenoxy)propyl]carbamate;tert-butyl N-[3-[4-(2-trimethylsilylethynyl)phenoxy]propyl]carbamate;ethynyl(trimethyl)silane |
| SMILES | C#C[Si](C)(C)C.CC(C)(C)OC(=O)NCCCOc1ccc(C#C[Si](C)(C)C)cc1.CC(C)(C)OC(=O)NCCCOc1ccc(I)cc1 |
| InChI | InChI=1S/C19H29NO3Si.C14H20INO3.C5H10Si/c1-19(2,3)23-18(21)20-13-7-14-22-17-10-8-16(9-11-17)12-15-24(4,5)6;1-14(2,3)19-13(17)16-9-4-10-18-12-7-5-11(15)6-8-12;1-5-6(2,3)4/h8-11H,7,13-14H2,1-6H3,(H,20,21);5-8H,4,9-10H2,1-3H3,(H,16,17);1H,2-4H3 |
| InChIKey | AEOJXDGYJMXWBR-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.97 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|