C25H39NO5Si — CID 168869190
methyl 2-methyl-5-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]-3-(2-trimethylsilylethynyl)benzoate (PubChem CID 168869190) has the molecular formula C25H39NO5Si and a molecular weight of 461.68 g/mol. Its IUPAC name is methyl 2-methyl-5-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]-3-(2-trimethylsilylethynyl)benzoate.
| Compound Name | methyl 2-methyl-5-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]-3-(2-trimethylsilylethynyl)benzoate |
|---|---|
| PubChem CID | 168869190 |
| Molecular Formula | C25H39NO5Si |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | methyl 2-methyl-5-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexoxy]-3-(2-trimethylsilylethynyl)benzoate |
| SMILES | COC(=O)c1cc(OCCCCCCNC(=O)OC(C)(C)C)cc(C#C[Si](C)(C)C)c1C |
| InChI | InChI=1S/C25H39NO5Si/c1-19-20(13-16-32(6,7)8)17-21(18-22(19)23(27)29-5)30-15-12-10-9-11-14-26-24(28)31-25(2,3)4/h17-18H,9-12,14-15H2,1-8H3,(H,26,28) |
| InChIKey | JVLNEXWBPLXDNU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|