About 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate
6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate (PubChem CID 159823301) has the molecular formula C26H37Br3N2O6
and a molecular weight of 713.30 g/mol. Its IUPAC name is 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate.
Molecular Properties
| Compound Name | 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate |
| PubChem CID | 159823301 |
| Molecular Formula | C26H37Br3N2O6 |
| Molecular Weight | 713.30 g/mol |
| Exact Mass | 710.02 |
| IUPAC Name | 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCBr.CC(C)(C)OC(=O)CCCOc1ccc(Br)nc1.Oc1ccc(Br)nc1 |
| InChI | InChI=1S/C13H18BrNO3.C8H15BrO2.C5H4BrNO/c1-13(2,3)18-12(16)5-4-8-17-10-6-7-11(14)15-9-10;1-8(2,3)11-7(10)5-4-6-9;6-5-2-1-4(8)3-7-5/h6-7,9H,4-5,8H2,1-3H3;4-6H2,1-3H3;1-3,8H |
| InChIKey | NMMZMKHIIQZSPL-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 713.30 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate?
The IUPAC name of 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate (CID 159823301) is 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate.
What is the SMILES notation for 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate?
The canonical SMILES for 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate is CC(C)(C)OC(=O)CCCBr.CC(C)(C)OC(=O)CCCOc1ccc(Br)nc1.Oc1ccc(Br)nc1.
What is the InChIKey of 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate?
The InChIKey is NMMZMKHIIQZSPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrNO3.C8H15BrO2.C5H4BrNO/c1-13(2,3)18-12(16)5-4-8-17-10-6-7-11(14)15-9-10;1-8(2,3)11-7(10)5-4-6-9;6-5-2-1-4(8)3-7-5/h6-7,9H,4-5,8H2,1-3H3;4-6H2,1-3H3;1-3,8H.
What are the key properties of 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate?
6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate has a molecular weight of 713.30 g/mol, XLogP of 7.40, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromopyridin-3-ol;tert-butyl 4-bromobutanoate;tert-butyl 4-[(6-bromo-3-pyridinyl)oxy]butanoate is sourced from PubChem (CID 159823301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).