C28H28N2O7 — CID 54381028
5-(3-anilino-3-phenylpropanoyl)oxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 54381028) has the molecular formula C28H28N2O7 and a molecular weight of 504.54 g/mol. Its IUPAC name is 5-(3-anilino-3-phenylpropanoyl)oxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-(3-anilino-3-phenylpropanoyl)oxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 54381028 |
| Molecular Formula | C28H28N2O7 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 5-(3-anilino-3-phenylpropanoyl)oxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | O=C(O)CC(NC(=O)OCc1ccccc1)C(=O)COC(=O)CC(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28N2O7/c31-25(24(16-26(32)33)30-28(35)37-18-20-10-4-1-5-11-20)19-36-27(34)17-23(21-12-6-2-7-13-21)29-22-14-8-3-9-15-22/h1-15,23-24,29H,16-19H2,(H,30,35)(H,32,33) |
| InChIKey | UZWYPHMZTHYELM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |