C22H24N2O7 — CID 54012511
5-[methyl-(2-phenylacetyl)amino]oxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 54012511) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is 5-[methyl-(2-phenylacetyl)amino]oxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-[methyl-(2-phenylacetyl)amino]oxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 54012511 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 5-[methyl-(2-phenylacetyl)amino]oxy-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | CN(OCC(=O)C(CC(=O)O)NC(=O)OCc1ccccc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C22H24N2O7/c1-24(20(26)12-16-8-4-2-5-9-16)31-15-19(25)18(13-21(27)28)23-22(29)30-14-17-10-6-3-7-11-17/h2-11,18H,12-15H2,1H3,(H,23,29)(H,27,28) |
| InChIKey | KTINDHDTYTVTNG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|