C23H28N2O6 — CID 22843570
2-(2-methylpropoxy)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid (PubChem CID 22843570) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-(2-methylpropoxy)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid.
| Compound Name | 2-(2-methylpropoxy)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 22843570 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 2-(2-methylpropoxy)-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid |
| SMILES | CC(C)COC(NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H28N2O6/c1-16(2)14-30-21(22(27)28)25-20(26)19(13-17-9-5-3-6-10-17)24-23(29)31-15-18-11-7-4-8-12-18/h3-12,16,19,21H,13-15H2,1-2H3,(H,24,29)(H,25,26)(H,27,28)/t19-,21?/m0/s1 |
| InChIKey | WAQGDXGOBGJVFV-ZQRQZVKFSA-N |
| XLogP | 2.72 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|