C21H39NO9S — CID 123309482
ditert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(3-sulfinooxypropyl)pentanedioate (PubChem CID 123309482) has the molecular formula C21H39NO9S and a molecular weight of 481.61 g/mol. Its IUPAC name is ditert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(3-sulfinooxypropyl)pentanedioate.
| Compound Name | ditert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(3-sulfinooxypropyl)pentanedioate |
|---|---|
| PubChem CID | 123309482 |
| Molecular Formula | C21H39NO9S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | ditert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(3-sulfinooxypropyl)pentanedioate |
| SMILES | CC(C)(C)OC(=O)NC(CC(CCCOS(=O)O)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39NO9S/c1-19(2,3)29-16(23)14(11-10-12-28-32(26)27)13-15(17(24)30-20(4,5)6)22-18(25)31-21(7,8)9/h14-15H,10-13H2,1-9H3,(H,22,25)(H,26,27) |
| InChIKey | DWXHWGAMMJKFFA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|