C29H46FNO7 — CID 89156295
ditert-butyl (5S)-2-[2-[4-(2-fluoroethoxy)phenyl]ethyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioate (PubChem CID 89156295) has the molecular formula C29H46FNO7 and a molecular weight of 539.69 g/mol. Its IUPAC name is ditert-butyl (5S)-2-[2-[4-(2-fluoroethoxy)phenyl]ethyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioate.
| Compound Name | ditert-butyl (5S)-2-[2-[4-(2-fluoroethoxy)phenyl]ethyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioate |
|---|---|
| PubChem CID | 89156295 |
| Molecular Formula | C29H46FNO7 |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.33 |
| IUPAC Name | ditert-butyl (5S)-2-[2-[4-(2-fluoroethoxy)phenyl]ethyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(CCc1ccc(OCCF)cc1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H46FNO7/c1-27(2,3)36-24(32)21(13-10-20-11-15-22(16-12-20)35-19-18-30)14-17-23(25(33)37-28(4,5)6)31-26(34)38-29(7,8)9/h11-12,15-16,21,23H,10,13-14,17-19H2,1-9H3,(H,31,34)/t21?,23-/m0/s1 |
| InChIKey | OOXFPOZZVMXVLK-YANBTOMASA-N |
| XLogP | 5.94 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|