C30H43NO7 — CID 70025163
tert-butyl 2-(1-adamantylmethoxycarbonylamino)-4-[4-(3-methoxy-3-oxopropyl)phenoxy]butanoate (PubChem CID 70025163) has the molecular formula C30H43NO7 and a molecular weight of 529.67 g/mol. Its IUPAC name is tert-butyl 2-(1-adamantylmethoxycarbonylamino)-4-[4-(3-methoxy-3-oxopropyl)phenoxy]butanoate.
| Compound Name | tert-butyl 2-(1-adamantylmethoxycarbonylamino)-4-[4-(3-methoxy-3-oxopropyl)phenoxy]butanoate |
|---|---|
| PubChem CID | 70025163 |
| Molecular Formula | C30H43NO7 |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | tert-butyl 2-(1-adamantylmethoxycarbonylamino)-4-[4-(3-methoxy-3-oxopropyl)phenoxy]butanoate |
| SMILES | COC(=O)CCc1ccc(OCCC(NC(=O)OCC23CC4CC(CC(C4)C2)C3)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H43NO7/c1-29(2,3)38-27(33)25(11-12-36-24-8-5-20(6-9-24)7-10-26(32)35-4)31-28(34)37-19-30-16-21-13-22(17-30)15-23(14-21)18-30/h5-6,8-9,21-23,25H,7,10-19H2,1-4H3,(H,31,34) |
| InChIKey | FUEJKZNFDCWMBI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|