C24H40N2O6 — CID 68828668
tert-butyl (2S)-2-(1-adamantylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 68828668) has the molecular formula C24H40N2O6 and a molecular weight of 452.59 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1-adamantylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | tert-butyl (2S)-2-(1-adamantylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 68828668 |
| Molecular Formula | C24H40N2O6 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | tert-butyl (2S)-2-(1-adamantylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NC[C@H](NC(=O)OCC12CC3CC(CC(C3)C1)C2)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H40N2O6/c1-22(2,3)31-19(27)18(13-25-20(28)32-23(4,5)6)26-21(29)30-14-24-10-15-7-16(11-24)9-17(8-15)12-24/h15-18H,7-14H2,1-6H3,(H,25,28)(H,26,29)/t15?,16?,17?,18-,24?/m0/s1 |
| InChIKey | AJUDCUMCCJRTSA-JNYXMARXSA-N |
| XLogP | 4.16 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|