C31H43NO7 — CID 131723246
tert-butyl (2S)-2-(1-adamantylmethoxycarbonylamino)-3-[4-(3-ethoxy-4-oxobut-3-enoxy)phenyl]propanoate (PubChem CID 131723246) has the molecular formula C31H43NO7 and a molecular weight of 541.69 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1-adamantylmethoxycarbonylamino)-3-[4-(3-ethoxy-4-oxobut-3-enoxy)phenyl]propanoate.
| Compound Name | tert-butyl (2S)-2-(1-adamantylmethoxycarbonylamino)-3-[4-(3-ethoxy-4-oxobut-3-enoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 131723246 |
| Molecular Formula | C31H43NO7 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | tert-butyl (2S)-2-(1-adamantylmethoxycarbonylamino)-3-[4-(3-ethoxy-4-oxobut-3-enoxy)phenyl]propanoate |
| SMILES | CCOC(=C=O)CCOc1ccc(C[C@H](NC(=O)OCC23CC4CC(CC(C4)C2)C3)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C31H43NO7/c1-5-36-26(19-33)10-11-37-25-8-6-21(7-9-25)15-27(28(34)39-30(2,3)4)32-29(35)38-20-31-16-22-12-23(17-31)14-24(13-22)18-31/h6-9,22-24,27H,5,10-18,20H2,1-4H3,(H,32,35)/t22?,23?,24?,27-,31?/m0/s1 |
| InChIKey | IIIUCXJVNAGWGK-PKIBYJIPSA-N |
| XLogP | 5.40 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|