C27H43NO7 — CID 70977973
ditert-butyl (5S)-2-[2-(4-hydroxyphenyl)ethyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioate (PubChem CID 70977973) has the molecular formula C27H43NO7 and a molecular weight of 493.64 g/mol. Its IUPAC name is ditert-butyl (5S)-2-[2-(4-hydroxyphenyl)ethyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioate.
| Compound Name | ditert-butyl (5S)-2-[2-(4-hydroxyphenyl)ethyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioate |
|---|---|
| PubChem CID | 70977973 |
| Molecular Formula | C27H43NO7 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | ditert-butyl (5S)-2-[2-(4-hydroxyphenyl)ethyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(CCc1ccc(O)cc1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H43NO7/c1-25(2,3)33-22(30)19(13-10-18-11-15-20(29)16-12-18)14-17-21(23(31)34-26(4,5)6)28-24(32)35-27(7,8)9/h11-12,15-16,19,21,29H,10,13-14,17H2,1-9H3,(H,28,32)/t19?,21-/m0/s1 |
| InChIKey | ZKTYGJPBDCCQTQ-QWAKEFERSA-N |
| XLogP | 5.30 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|