C16H32N6O3 — CID 10155227
(2S,3S)-2-acetamido-N-[(2S)-5-(diaminomethylideneamino)-1-(ethylamino)-1-oxopentan-2-yl]-3-methylpentanamide (PubChem CID 10155227) has the molecular formula C16H32N6O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2S,3S)-2-acetamido-N-[(2S)-5-(diaminomethylideneamino)-1-(ethylamino)-1-oxopentan-2-yl]-3-methylpentanamide.
| Compound Name | (2S,3S)-2-acetamido-N-[(2S)-5-(diaminomethylideneamino)-1-(ethylamino)-1-oxopentan-2-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 10155227 |
| Molecular Formula | C16H32N6O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | (2S,3S)-2-acetamido-N-[(2S)-5-(diaminomethylideneamino)-1-(ethylamino)-1-oxopentan-2-yl]-3-methylpentanamide |
| SMILES | CCNC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](NC(C)=O)[C@@H](C)CC |
| InChI | InChI=1S/C16H32N6O3/c1-5-10(3)13(21-11(4)23)15(25)22-12(14(24)19-6-2)8-7-9-20-16(17)18/h10,12-13H,5-9H2,1-4H3,(H,19,24)(H,21,23)(H,22,25)(H4,17,18,20)/t10-,12-,13-/m0/s1 |
| InChIKey | JOYZESBFSMCRAM-DRZSPHRISA-N |
| XLogP | -0.79 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|