C21H41N7O5 — CID 18233165
2-[[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-3-methylpentanoic acid (PubChem CID 18233165) has the molecular formula C21H41N7O5 and a molecular weight of 471.60 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18233165 |
| Molecular Formula | C21H41N7O5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-methylpentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(C)N)C(C)CC)C(=O)O |
| InChI | InChI=1S/C21H41N7O5/c1-6-11(3)15(19(31)28-16(20(32)33)12(4)7-2)27-18(30)14(26-17(29)13(5)22)9-8-10-25-21(23)24/h11-16H,6-10,22H2,1-5H3,(H,26,29)(H,27,30)(H,28,31)(H,32,33)(H4,23,24,25) |
| InChIKey | QRCKRRJUUBGURC-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|