C7H18N4O2 — CID 126727356
2-[(4S)-5,5-dihydroxy-4-(methylamino)pentyl]guanidine (PubChem CID 126727356) has the molecular formula C7H18N4O2 and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-[(4S)-5,5-dihydroxy-4-(methylamino)pentyl]guanidine.
| Compound Name | 2-[(4S)-5,5-dihydroxy-4-(methylamino)pentyl]guanidine |
|---|---|
| PubChem CID | 126727356 |
| Molecular Formula | C7H18N4O2 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 2-[(4S)-5,5-dihydroxy-4-(methylamino)pentyl]guanidine |
| SMILES | CN[C@@H](CCCN=C(N)N)C(O)O |
| InChI | InChI=1S/C7H18N4O2/c1-10-5(6(12)13)3-2-4-11-7(8)9/h5-6,10,12-13H,2-4H2,1H3,(H4,8,9,11)/t5-/m0/s1 |
| InChIKey | ZGLTXHRVCJOZPQ-YFKPBYRVSA-N |
| XLogP | -2.06 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|