C26H34N10O3 — CID 11656698
N'-[(2S)-1-[4-(diaminomethylideneamino)butylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-N-(2H-tetrazol-5-yl)pentanediamide (PubChem CID 11656698) has the molecular formula C26H34N10O3 and a molecular weight of 534.63 g/mol. Its IUPAC name is N'-[(2S)-1-[4-(diaminomethylideneamino)butylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-N-(2H-tetrazol-5-yl)pentanediamide.
| Compound Name | N'-[(2S)-1-[4-(diaminomethylideneamino)butylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-N-(2H-tetrazol-5-yl)pentanediamide |
|---|---|
| PubChem CID | 11656698 |
| Molecular Formula | C26H34N10O3 |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | N'-[(2S)-1-[4-(diaminomethylideneamino)butylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-N-(2H-tetrazol-5-yl)pentanediamide |
| SMILES | NC(N)=NCCCCNC(=O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)CCCC(=O)Nc1nn[nH]n1 |
| InChI | InChI=1S/C26H34N10O3/c27-25(28)30-16-5-4-15-29-24(39)21(17-18-11-13-20(14-12-18)19-7-2-1-3-8-19)31-22(37)9-6-10-23(38)32-26-33-35-36-34-26/h1-3,7-8,11-14,21H,4-6,9-10,15-17H2,(H,29,39)(H,31,37)(H4,27,28,30)(H2,32,33,34,35,36,38)/t21-/m0/s1 |
| InChIKey | VGVVJOWMJUWDAK-NRFANRHFSA-N |
| XLogP | 0.87 |
| TPSA | 206.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|