C30H41N3O10 — CID 22084035
4-[[1-[[3-[4-(2-hydroperoxyethoxy)-3-(hydroperoxymethyl)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 22084035) has the molecular formula C30H41N3O10 and a molecular weight of 603.67 g/mol. Its IUPAC name is 4-[[1-[[3-[4-(2-hydroperoxyethoxy)-3-(hydroperoxymethyl)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[1-[[3-[4-(2-hydroperoxyethoxy)-3-(hydroperoxymethyl)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22084035 |
| Molecular Formula | C30H41N3O10 |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | 4-[[1-[[3-[4-(2-hydroperoxyethoxy)-3-(hydroperoxymethyl)phenyl]-1-oxo-1-(pentylamino)propan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OCCOO)c(COO)c1)NC(=O)C(Cc1ccccc1)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C30H41N3O10/c1-2-3-7-14-31-29(37)24(19-22-10-11-26(41-15-16-42-39)23(17-22)20-43-40)33-30(38)25(18-21-8-5-4-6-9-21)32-27(34)12-13-28(35)36/h4-6,8-11,17,24-25,39-40H,2-3,7,12-16,18-20H2,1H3,(H,31,37)(H,32,34)(H,33,38)(H,35,36) |
| InChIKey | UQRAXSDLVWZZPV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 192.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|