C23H33NO7 — CID 57128737
1-O-cyclopentyl 5-O-[(4-methoxyphenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 57128737) has the molecular formula C23H33NO7 and a molecular weight of 435.52 g/mol. Its IUPAC name is 1-O-cyclopentyl 5-O-[(4-methoxyphenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | 1-O-cyclopentyl 5-O-[(4-methoxyphenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 57128737 |
| Molecular Formula | C23H33NO7 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-O-cyclopentyl 5-O-[(4-methoxyphenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | COc1ccc(COC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)OC2CCCC2)cc1 |
| InChI | InChI=1S/C23H33NO7/c1-23(2,3)31-22(27)24-19(21(26)30-18-7-5-6-8-18)13-14-20(25)29-15-16-9-11-17(28-4)12-10-16/h9-12,18-19H,5-8,13-15H2,1-4H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | KRJTVPBNICNXBZ-IBGZPJMESA-N |
| XLogP | 3.90 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|