C27H37NO7 — CID 21076736
4-O-(2-adamantyl) 1-O-[(4-methoxyphenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 21076736) has the molecular formula C27H37NO7 and a molecular weight of 487.59 g/mol. Its IUPAC name is 4-O-(2-adamantyl) 1-O-[(4-methoxyphenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
| Compound Name | 4-O-(2-adamantyl) 1-O-[(4-methoxyphenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
|---|---|
| PubChem CID | 21076736 |
| Molecular Formula | C27H37NO7 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 4-O-(2-adamantyl) 1-O-[(4-methoxyphenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | COc1ccc(COC(=O)[C@H](CC(=O)OC2C3CC4CC(C3)CC2C4)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H37NO7/c1-27(2,3)35-26(31)28-22(25(30)33-15-16-5-7-21(32-4)8-6-16)14-23(29)34-24-19-10-17-9-18(12-19)13-20(24)11-17/h5-8,17-20,22,24H,9-15H2,1-4H3,(H,28,31)/t17?,18?,19?,20?,22-,24?/m0/s1 |
| InChIKey | VPPWSNFPXLNXBS-YCFKCBMSSA-N |
| XLogP | 4.39 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|