C24H35NO6 — CID 51340780
5-O-cyclohexyl 1-O-[(4-methylphenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 51340780) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is 5-O-cyclohexyl 1-O-[(4-methylphenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | 5-O-cyclohexyl 1-O-[(4-methylphenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 51340780 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 5-O-cyclohexyl 1-O-[(4-methylphenyl)methyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | Cc1ccc(COC(=O)[C@H](CCC(=O)OC2CCCCC2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H35NO6/c1-17-10-12-18(13-11-17)16-29-22(27)20(25-23(28)31-24(2,3)4)14-15-21(26)30-19-8-6-5-7-9-19/h10-13,19-20H,5-9,14-16H2,1-4H3,(H,25,28)/t20-/m0/s1 |
| InChIKey | RBIBMHKAZUKDCZ-FQEVSTJZSA-N |
| XLogP | 4.59 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|