C23H20F7NO6 — CID 163550987
5-O-(2,3,5,6-tetrafluorophenyl) 1-O-(2,3,6-trifluoro-5-methylphenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 163550987) has the molecular formula C23H20F7NO6 and a molecular weight of 539.40 g/mol. Its IUPAC name is 5-O-(2,3,5,6-tetrafluorophenyl) 1-O-(2,3,6-trifluoro-5-methylphenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | 5-O-(2,3,5,6-tetrafluorophenyl) 1-O-(2,3,6-trifluoro-5-methylphenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 163550987 |
| Molecular Formula | C23H20F7NO6 |
| Molecular Weight | 539.40 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 5-O-(2,3,5,6-tetrafluorophenyl) 1-O-(2,3,6-trifluoro-5-methylphenyl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | Cc1cc(F)c(F)c(OC(=O)C(CCC(=O)Oc2c(F)c(F)cc(F)c2F)NC(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C23H20F7NO6/c1-9-7-10(24)16(28)19(15(9)27)36-21(33)13(31-22(34)37-23(2,3)4)5-6-14(32)35-20-17(29)11(25)8-12(26)18(20)30/h7-8,13H,5-6H2,1-4H3,(H,31,34) |
| InChIKey | FJBFPSJDEUCXOU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|