C29H57N5O9S — CID 176682074
tert-butyl N-[1-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]butylsulfanyl]-1-oxobutan-2-yl]carbamate (PubChem CID 176682074) has the molecular formula C29H57N5O9S and a molecular weight of 651.87 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]butylsulfanyl]-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]butylsulfanyl]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 176682074 |
| Molecular Formula | C29H57N5O9S |
| Molecular Weight | 651.87 g/mol |
| Exact Mass | 651.39 |
| IUPAC Name | tert-butyl N-[1-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-4-[3,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]butylsulfanyl]-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(CCSCCC(NC(=O)OC(C)(C)C)C(=O)NCCOCCOCCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H57N5O9S/c1-27(2,3)41-24(36)32-20-21(33-25(37)42-28(4,5)6)10-18-44-19-11-22(34-26(38)43-29(7,8)9)23(35)31-13-15-40-17-16-39-14-12-30/h21-22H,10-20,30H2,1-9H3,(H,31,35)(H,32,36)(H,33,37)(H,34,38) |
| InChIKey | HHGMCBUXNXTHEA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 188.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.87 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|