C16H31N3O7 — CID 169075876
tert-butyl N-[(2S)-3-hydroxy-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxycarbonylamino]propyl]carbamate (PubChem CID 169075876) has the molecular formula C16H31N3O7 and a molecular weight of 377.44 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-hydroxy-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxycarbonylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-hydroxy-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 169075876 |
| Molecular Formula | C16H31N3O7 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | tert-butyl N-[(2S)-3-hydroxy-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxycarbonylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOC(=O)N[C@H](CO)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31N3O7/c1-15(2,3)25-12(21)17-7-8-24-14(23)19-11(10-20)9-18-13(22)26-16(4,5)6/h11,20H,7-10H2,1-6H3,(H,17,21)(H,18,22)(H,19,23)/t11-/m0/s1 |
| InChIKey | YNMFNAZDDRTQLU-NSHDSACASA-N |
| XLogP | 1.12 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|