C24H44O9 — CID 89312256
tert-butyl 3-[2,3-bis[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propoxy]propanoate (PubChem CID 89312256) has the molecular formula C24H44O9 and a molecular weight of 476.61 g/mol. Its IUPAC name is tert-butyl 3-[2,3-bis[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propoxy]propanoate.
| Compound Name | tert-butyl 3-[2,3-bis[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propoxy]propanoate |
|---|---|
| PubChem CID | 89312256 |
| Molecular Formula | C24H44O9 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | tert-butyl 3-[2,3-bis[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]propoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCC(COCCC(=O)OC(C)(C)C)OCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H44O9/c1-22(2,3)31-19(25)10-13-28-16-18(30-15-12-21(27)33-24(7,8)9)17-29-14-11-20(26)32-23(4,5)6/h18H,10-17H2,1-9H3 |
| InChIKey | RXZHTTPWFBGJSL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|