C12H24FmNO5- — CID 167509076
fermium;[[1-hydroxy-3-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]propan-2-yl]amino]methanone (PubChem CID 167509076) has the molecular formula C12H24FmNO5- and a molecular weight of 519.33 g/mol. Its IUPAC name is fermium;[[1-hydroxy-3-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]propan-2-yl]amino]methanone.
| Compound Name | fermium;[[1-hydroxy-3-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]propan-2-yl]amino]methanone |
|---|---|
| PubChem CID | 167509076 |
| Molecular Formula | C12H24FmNO5- |
| Molecular Weight | 519.33 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | fermium;[[1-hydroxy-3-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]propan-2-yl]amino]methanone |
| SMILES | CC(C)(C)OCCOCCOCC(CO)N[C-]=O.[Fm] |
| InChI | InChI=1S/C12H24NO5.Fm/c1-12(2,3)18-7-6-16-4-5-17-9-11(8-14)13-10-15;/h11,14H,4-9H2,1-3H3,(H,13,15);/q-1; |
| InChIKey | IQDSLIKOQHYMNO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.33 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|