C10H16FmNO7- — CID 172576763
3-[3-(2-carboxyethoxy)-2-(oxomethylamino)propoxy]propanoic acid;fermium (PubChem CID 172576763) has the molecular formula C10H16FmNO7- and a molecular weight of 519.24 g/mol. Its IUPAC name is 3-[3-(2-carboxyethoxy)-2-(oxomethylamino)propoxy]propanoic acid;fermium.
| Compound Name | 3-[3-(2-carboxyethoxy)-2-(oxomethylamino)propoxy]propanoic acid;fermium |
|---|---|
| PubChem CID | 172576763 |
| Molecular Formula | C10H16FmNO7- |
| Molecular Weight | 519.24 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 3-[3-(2-carboxyethoxy)-2-(oxomethylamino)propoxy]propanoic acid;fermium |
| SMILES | O=[C-]NC(COCCC(=O)O)COCCC(=O)O.[Fm] |
| InChI | InChI=1S/C10H16NO7.Fm/c12-7-11-8(5-17-3-1-9(13)14)6-18-4-2-10(15)16;/h8H,1-6H2,(H,11,12)(H,13,14)(H,15,16);/q-1; |
| InChIKey | ZVSTVDVYPGEARQ-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.24 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|